C10H16O4 — CID 24814758
methyl 2-[(3aR,4R,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl]acetate (PubChem CID 24814758) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl]acetate |
|---|---|
| PubChem CID | 24814758 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 2-[(3aR,4R,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCO[C@@H]2OCC[C@H]12 |
| InChI | InChI=1S/C10H16O4/c1-12-9(11)6-7-2-4-13-10-8(7)3-5-14-10/h7-8,10H,2-6H2,1H3/t7-,8-,10-/m1/s1 |
| InChIKey | LLZDPBZKNBBFAW-NQMVMOMDSA-N |
| XLogP | 0.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |