C21H20F3N5O3 — CID 23517134
(3E)-1-[[1-(4-hydroxybutyl)benzimidazol-2-yl]methyl]-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one (PubChem CID 23517134) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is (3E)-1-[[1-(4-hydroxybutyl)benzimidazol-2-yl]methyl]-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3E)-1-[[1-(4-hydroxybutyl)benzimidazol-2-yl]methyl]-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 23517134 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (3E)-1-[[1-(4-hydroxybutyl)benzimidazol-2-yl]methyl]-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1/C(=N/OCC(F)(F)F)c2cccnc2N1Cc1nc2ccccc2n1CCCCO |
| InChI | InChI=1S/C21H20F3N5O3/c22-21(23,24)13-32-27-18-14-6-5-9-25-19(14)29(20(18)31)12-17-26-15-7-1-2-8-16(15)28(17)10-3-4-11-30/h1-2,5-9,30H,3-4,10-13H2/b27-18+ |
| InChIKey | LXKLQXIFQAVLJA-OVVQPSECSA-N |
| XLogP | 3.03 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|