C21H30O3 — CID 23517407
3-(1-hydroxycyclopentyl)propyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 23517407) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-(1-hydroxycyclopentyl)propyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | 3-(1-hydroxycyclopentyl)propyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 23517407 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3-(1-hydroxycyclopentyl)propyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C(OCCCC1(O)CCCC1)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C21H30O3/c22-20(24-9-3-8-21(23)6-1-2-7-21)17-12-15-11-16(17)19-14-5-4-13(10-14)18(15)19/h4-5,13-19,23H,1-3,6-12H2 |
| InChIKey | RYYWKNPAWCFRJF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|