About actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one
actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one (PubChem CID 23518642) has the molecular formula C9H15AcN3O2
and a molecular weight of 424.24 g/mol. Its IUPAC name is actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one |
| PubChem CID | 23518642 |
| Molecular Formula | C9H15AcN3O2 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one |
| SMILES | Cc1nc(N)cc(=O)n1CCCCO.[Ac] |
| InChI | InChI=1S/C9H15N3O2.Ac/c1-7-11-8(10)6-9(14)12(7)4-2-3-5-13;/h6,13H,2-5,10H2,1H3; |
| InChIKey | NAEXNCJCKOLLFN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one?
The IUPAC name of actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one (CID 23518642) is actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one.
What is the SMILES notation for actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one?
The canonical SMILES for actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one is Cc1nc(N)cc(=O)n1CCCCO.[Ac].
What is the InChIKey of actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one?
The InChIKey is NAEXNCJCKOLLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2.Ac/c1-7-11-8(10)6-9(14)12(7)4-2-3-5-13;/h6,13H,2-5,10H2,1H3;.
What are the key properties of actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one?
actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one has a molecular weight of 424.24 g/mol, XLogP of -0.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;6-amino-3-(4-hydroxybutyl)-2-methylpyrimidin-4-one is sourced from PubChem (CID 23518642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).