C10H16N2O2 — CID 63769737
3-(4-hydroxybutyl)-2,6-dimethylpyrimidin-4-one (PubChem CID 63769737) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-(4-hydroxybutyl)-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 63769737 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-(4-hydroxybutyl)-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(CCCCO)c(C)n1 |
| InChI | InChI=1S/C10H16N2O2/c1-8-7-10(14)12(9(2)11-8)5-3-4-6-13/h7,13H,3-6H2,1-2H3 |
| InChIKey | VKYZBLCPETUXAT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|