C13H24O4 — CID 23522006
1-ethoxyethyl 2,5-diethyloxolane-3-carboxylate (PubChem CID 23522006) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-ethoxyethyl 2,5-diethyloxolane-3-carboxylate.
| Compound Name | 1-ethoxyethyl 2,5-diethyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 23522006 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-ethoxyethyl 2,5-diethyloxolane-3-carboxylate |
| SMILES | CCOC(C)OC(=O)C1CC(CC)OC1CC |
| InChI | InChI=1S/C13H24O4/c1-5-10-8-11(12(6-2)17-10)13(14)16-9(4)15-7-3/h9-12H,5-8H2,1-4H3 |
| InChIKey | PXFRBTQIXSVYCM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|