C18H21NO6 — CID 2352576
[2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 2352576) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 2352576 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)NCc2ccco2)cc1OCC |
| InChI | InChI=1S/C18H21NO6/c1-3-22-15-8-7-13(10-16(15)23-4-2)18(21)25-12-17(20)19-11-14-6-5-9-24-14/h5-10H,3-4,11-12H2,1-2H3,(H,19,20) |
| InChIKey | FNVAUFXJWDEMQS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |