C45H43NO4P2 — CID 23525881
6-[2-[3,5-dimethyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-4,6-dimethylphenoxy]-5-methylbenzo[c][2,1]benzazaphosphinine (PubChem CID 23525881) has the molecular formula C45H43NO4P2 and a molecular weight of 723.79 g/mol. Its IUPAC name is 6-[2-[3,5-dimethyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-4,6-dimethylphenoxy]-5-methylbenzo[c][2,1]benzazaphosphinine.
| Compound Name | 6-[2-[3,5-dimethyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-4,6-dimethylphenoxy]-5-methylbenzo[c][2,1]benzazaphosphinine |
|---|---|
| PubChem CID | 23525881 |
| Molecular Formula | C45H43NO4P2 |
| Molecular Weight | 723.79 g/mol |
| Exact Mass | 723.27 |
| IUPAC Name | 6-[2-[3,5-dimethyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-4,6-dimethylphenoxy]-5-methylbenzo[c][2,1]benzazaphosphinine |
| SMILES | Cc1cc(C)c(OP2c3ccccc3-c3ccccc3N2C)c(-c2cc(C)cc(C)c2Op2oc3c(C)cc(C)cc3c3cc(C)cc(C)c3o2)c1 |
| InChI | InChI=1S/C45H43NO4P2/c1-26-18-30(5)42(47-51-41-17-13-11-15-35(41)34-14-10-12-16-40(34)46(51)9)36(22-26)37-23-27(2)19-31(6)43(37)48-52-49-44-32(7)20-28(3)24-38(44)39-25-29(4)21-33(8)45(39)50-52/h10-25H,1-9H3 |
| InChIKey | YYSFROFCBPRGJC-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 47.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.79 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|