C36H42O7P2 — CID 59931129
[4-methoxy-3,6-dimethyl-2-[2,3,5-trimethyl-6-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] dimethyl phosphite (PubChem CID 59931129) has the molecular formula C36H42O7P2 and a molecular weight of 648.67 g/mol. Its IUPAC name is [4-methoxy-3,6-dimethyl-2-[2,3,5-trimethyl-6-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] dimethyl phosphite.
| Compound Name | [4-methoxy-3,6-dimethyl-2-[2,3,5-trimethyl-6-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] dimethyl phosphite |
|---|---|
| PubChem CID | 59931129 |
| Molecular Formula | C36H42O7P2 |
| Molecular Weight | 648.67 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | [4-methoxy-3,6-dimethyl-2-[2,3,5-trimethyl-6-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] dimethyl phosphite |
| SMILES | COc1cc(C)c(OP(OC)OC)c(-c2c(C)c(C)cc(C)c2Op2oc3c(C)cc(C)cc3c3cc(C)cc(C)c3o2)c1C |
| InChI | InChI=1S/C36H42O7P2/c1-19-13-22(4)33-28(15-19)29-16-20(2)14-23(5)34(29)41-45(40-33)43-35-24(6)17-21(3)26(8)31(35)32-27(9)30(37-10)18-25(7)36(32)42-44(38-11)39-12/h13-18H,1-12H3 |
| InChIKey | BKFRRMKXNZJWHL-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 72.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.67 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|