C23H33BrN4O4Si — CID 23527081
7-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-ethylpurine-2,6-dione (PubChem CID 23527081) has the molecular formula C23H33BrN4O4Si and a molecular weight of 537.53 g/mol. Its IUPAC name is 7-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-ethylpurine-2,6-dione.
| Compound Name | 7-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 23527081 |
| Molecular Formula | C23H33BrN4O4Si |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 7-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-ethylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccc(OC)c(Br)c2)n(CCO[Si](C)(C)C(C)(C)C)c1=O |
| InChI | InChI=1S/C23H33BrN4O4Si/c1-8-27-21(29)19-20(28(22(27)30)11-12-32-33(6,7)23(2,3)4)25-15-26(19)14-16-9-10-18(31-5)17(24)13-16/h9-10,13,15H,8,11-12,14H2,1-7H3 |
| InChIKey | MRLIAQQVMNVZSM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|