C46H84O6 — CID 23527442
[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-7,7-bis[(E)-undec-2-enyl]octadec-9-enoate (PubChem CID 23527442) has the molecular formula C46H84O6 and a molecular weight of 733.17 g/mol. Its IUPAC name is [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-7,7-bis[(E)-undec-2-enyl]octadec-9-enoate.
| Compound Name | [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-7,7-bis[(E)-undec-2-enyl]octadec-9-enoate |
|---|---|
| PubChem CID | 23527442 |
| Molecular Formula | C46H84O6 |
| Molecular Weight | 733.17 g/mol |
| Exact Mass | 732.63 |
| IUPAC Name | [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-7,7-bis[(E)-undec-2-enyl]octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CC(C/C=C/CCCCCCCC)(C/C=C/CCCCCCCC)CCCCCC(=O)OCC(O)C1OCC(O)C1O |
| InChI | InChI=1S/C46H84O6/c1-4-7-10-13-16-19-22-25-30-35-46(36-31-26-23-20-17-14-11-8-5-2,37-32-27-24-21-18-15-12-9-6-3)38-33-28-29-34-43(49)51-40-42(48)45-44(50)41(47)39-52-45/h25-27,30-32,41-42,44-45,47-48,50H,4-24,28-29,33-40H2,1-3H3/b30-25+,31-26+,32-27+ |
| InChIKey | UKBIESKZGNUQPQ-LEACHKHPSA-N |
| XLogP | 12.04 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.17 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|