C42H50N2O6 — CID 23527514
5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9-methyl-9H-fluoren-2-yl]oxymethoxy]pyridine (PubChem CID 23527514) has the molecular formula C42H50N2O6 and a molecular weight of 678.87 g/mol. Its IUPAC name is 5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9-methyl-9H-fluoren-2-yl]oxymethoxy]pyridine.
| Compound Name | 5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9-methyl-9H-fluoren-2-yl]oxymethoxy]pyridine |
|---|---|
| PubChem CID | 23527514 |
| Molecular Formula | C42H50N2O6 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | 5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9-methyl-9H-fluoren-2-yl]oxymethoxy]pyridine |
| SMILES | C=COCCCCCCOc1ccc(Cc2ccc3c(c2)C(C)c2cc(OCOc4ccc(OCCCCCCOC=C)cn4)ccc2-3)nc1 |
| InChI | InChI=1S/C42H50N2O6/c1-4-45-22-10-6-8-12-24-47-36-16-15-34(43-29-36)26-33-14-19-38-39-20-17-35(28-41(39)32(3)40(38)27-33)49-31-50-42-21-18-37(30-44-42)48-25-13-9-7-11-23-46-5-2/h4-5,14-21,27-30,32H,1-2,6-13,22-26,31H2,3H3 |
| InChIKey | ZDVGPXWBRWNAGQ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|