C43H46F2N2O8 — CID 23527535
6-[[6-[[9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate (PubChem CID 23527535) has the molecular formula C43H46F2N2O8 and a molecular weight of 756.84 g/mol. Its IUPAC name is 6-[[6-[[9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate.
| Compound Name | 6-[[6-[[9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 23527535 |
| Molecular Formula | C43H46F2N2O8 |
| Molecular Weight | 756.84 g/mol |
| Exact Mass | 756.32 |
| IUPAC Name | 6-[[6-[[9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(Cc2ccc3c(c2)C(F)(F)c2cc(OCOc4ccc(OCCCCCCOC(=O)C=C)cn4)ccc2-3)nc1 |
| InChI | InChI=1S/C43H46F2N2O8/c1-3-41(48)52-23-11-7-5-9-21-50-34-15-14-32(46-28-34)25-31-13-18-36-37-19-16-33(27-39(37)43(44,45)38(36)26-31)54-30-55-40-20-17-35(29-47-40)51-22-10-6-8-12-24-53-42(49)4-2/h3-4,13-20,26-29H,1-2,5-12,21-25,30H2 |
| InChIKey | UVIZDIICJHVZRX-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.84 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|