C39H40N2O6 — CID 23527489
3-[[6-[2-[7-[2-[6-(3-prop-2-enoyloxypropoxy)-3-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]-3-pyridinyl]oxy]propyl prop-2-enoate (PubChem CID 23527489) has the molecular formula C39H40N2O6 and a molecular weight of 632.76 g/mol. Its IUPAC name is 3-[[6-[2-[7-[2-[6-(3-prop-2-enoyloxypropoxy)-3-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]-3-pyridinyl]oxy]propyl prop-2-enoate.
| Compound Name | 3-[[6-[2-[7-[2-[6-(3-prop-2-enoyloxypropoxy)-3-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]-3-pyridinyl]oxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 23527489 |
| Molecular Formula | C39H40N2O6 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 3-[[6-[2-[7-[2-[6-(3-prop-2-enoyloxypropoxy)-3-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]-3-pyridinyl]oxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(CCc2ccc3c(c2)Cc2cc(CCc4ccc(OCCCOC(=O)C=C)nc4)ccc2-3)nc1 |
| InChI | InChI=1S/C39H40N2O6/c1-3-38(42)46-21-5-19-44-34-15-14-33(40-27-34)13-9-29-11-17-36-32(24-29)25-31-23-28(10-16-35(31)36)7-8-30-12-18-37(41-26-30)45-20-6-22-47-39(43)4-2/h3-4,10-12,14-18,23-24,26-27H,1-2,5-9,13,19-22,25H2 |
| InChIKey | WRTBVVRRGHATLL-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|