C43H44F2N2O10 — CID 59768879
[9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyridine-2-carboxylate (PubChem CID 59768879) has the molecular formula C43H44F2N2O10 and a molecular weight of 786.82 g/mol. Its IUPAC name is [9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyridine-2-carboxylate.
| Compound Name | [9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59768879 |
| Molecular Formula | C43H44F2N2O10 |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | [9,9-difluoro-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]fluoren-2-yl] 5-(6-prop-2-enoyloxyhexoxy)pyridine-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OCOc2ccc3c(c2)C(F)(F)c2cc(OC(=O)c4ccc(OCCCCCCOC(=O)C=C)cn4)ccc2-3)nc1 |
| InChI | InChI=1S/C43H44F2N2O10/c1-3-40(48)53-23-11-7-5-9-21-51-32-15-19-38(46-27-32)42(50)57-31-14-18-35-34-17-13-30(25-36(34)43(44,45)37(35)26-31)55-29-56-39-20-16-33(28-47-39)52-22-10-6-8-12-24-54-41(49)4-2/h3-4,13-20,25-28H,1-2,5-12,21-24,29H2 |
| InChIKey | ONNJJGDKAAJANO-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 141.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|