C32H36N6O6 — CID 23529148
tert-butyl 4-methyl-3,5-dioxo-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-20-carboxylate (PubChem CID 23529148) has the molecular formula C32H36N6O6 and a molecular weight of 600.68 g/mol. Its IUPAC name is tert-butyl 4-methyl-3,5-dioxo-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-20-carboxylate.
| Compound Name | tert-butyl 4-methyl-3,5-dioxo-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-20-carboxylate |
|---|---|
| PubChem CID | 23529148 |
| Molecular Formula | C32H36N6O6 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | tert-butyl 4-methyl-3,5-dioxo-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-20-carboxylate |
| SMILES | CN1C(=O)C2=C(C1=O)c1cn(c3ncccc13)CCOCCN(C(=O)OC(C)(C)C)CCOCCn1cc2c2cccnc21 |
| InChI | InChI=1S/C32H36N6O6/c1-32(2,3)44-31(41)36-11-15-42-17-13-37-19-23(21-7-5-9-33-27(21)37)25-26(30(40)35(4)29(25)39)24-20-38(14-18-43-16-12-36)28-22(24)8-6-10-34-28/h5-10,19-20H,11-18H2,1-4H3 |
| InChIKey | ULJCWNDKKYZXDU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 121.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|