C18H17F5N2O3S — CID 2353092
N-[2-(diethylsulfamoyl)-4-methylphenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 2353092) has the molecular formula C18H17F5N2O3S and a molecular weight of 436.40 g/mol. Its IUPAC name is N-[2-(diethylsulfamoyl)-4-methylphenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[2-(diethylsulfamoyl)-4-methylphenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 2353092 |
| Molecular Formula | C18H17F5N2O3S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[2-(diethylsulfamoyl)-4-methylphenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C)ccc1NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H17F5N2O3S/c1-4-25(5-2)29(27,28)11-8-9(3)6-7-10(11)24-18(26)12-13(19)15(21)17(23)16(22)14(12)20/h6-8H,4-5H2,1-3H3,(H,24,26) |
| InChIKey | VBYPSMWJCSMALV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|