C17H22N4O2S2 — CID 2397328
1-[2-(diethylsulfamoyl)-4-methylphenyl]-3-pyridin-3-ylthiourea (PubChem CID 2397328) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)-4-methylphenyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[2-(diethylsulfamoyl)-4-methylphenyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 2397328 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)-4-methylphenyl]-3-pyridin-3-ylthiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C)ccc1NC(=S)Nc1cccnc1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-4-21(5-2)25(22,23)16-11-13(3)8-9-15(16)20-17(24)19-14-7-6-10-18-12-14/h6-12H,4-5H2,1-3H3,(H2,19,20,24) |
| InChIKey | MRIRJFPMNNSBLD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|