C18H18N4O4 — CID 23531486
4-N'-(4-acetylbenzoyl)-1-N'-methylbenzene-1,4-dicarbohydrazide (PubChem CID 23531486) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-N'-(4-acetylbenzoyl)-1-N'-methylbenzene-1,4-dicarbohydrazide.
| Compound Name | 4-N'-(4-acetylbenzoyl)-1-N'-methylbenzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 23531486 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4-N'-(4-acetylbenzoyl)-1-N'-methylbenzene-1,4-dicarbohydrazide |
| SMILES | CNNC(=O)c1ccc(C(=O)NNC(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H18N4O4/c1-11(23)12-3-5-14(6-4-12)17(25)21-22-18(26)15-9-7-13(8-10-15)16(24)20-19-2/h3-10,19H,1-2H3,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | RWKOYZCHXPHZCQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|