C74H70N2O6 — CID 23533096
[4-[3-[4-(4-heptylbenzoyl)oxyphenyl]-2,4-bis[[4-(2-phenylethynyl)phenyl]carbamoyl]cyclobutyl]phenyl] 4-heptylbenzoate (PubChem CID 23533096) has the molecular formula C74H70N2O6 and a molecular weight of 1083.38 g/mol. Its IUPAC name is [4-[3-[4-(4-heptylbenzoyl)oxyphenyl]-2,4-bis[[4-(2-phenylethynyl)phenyl]carbamoyl]cyclobutyl]phenyl] 4-heptylbenzoate.
| Compound Name | [4-[3-[4-(4-heptylbenzoyl)oxyphenyl]-2,4-bis[[4-(2-phenylethynyl)phenyl]carbamoyl]cyclobutyl]phenyl] 4-heptylbenzoate |
|---|---|
| PubChem CID | 23533096 |
| Molecular Formula | C74H70N2O6 |
| Molecular Weight | 1083.38 g/mol |
| Exact Mass | 1082.52 |
| IUPAC Name | [4-[3-[4-(4-heptylbenzoyl)oxyphenyl]-2,4-bis[[4-(2-phenylethynyl)phenyl]carbamoyl]cyclobutyl]phenyl] 4-heptylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccc(C3C(C(=O)Nc4ccc(C#Cc5ccccc5)cc4)C(c4ccc(OC(=O)c5ccc(CCCCCCC)cc5)cc4)C3C(=O)Nc3ccc(C#Cc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C74H70N2O6/c1-3-5-7-9-13-23-55-29-37-61(38-30-55)73(79)81-65-49-41-59(42-50-65)67-69(71(77)75-63-45-33-57(34-46-63)27-25-53-19-15-11-16-20-53)68(70(67)72(78)76-64-47-35-58(36-48-64)28-26-54-21-17-12-18-22-54)60-43-51-66(52-44-60)82-74(80)62-39-31-56(32-40-62)24-14-10-8-6-4-2/h11-12,15-22,29-52,67-70H,3-10,13-14,23-24H2,1-2H3,(H,75,77)(H,76,78) |
| InChIKey | IXNJQPOBFLUAGR-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.38 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|