C16H22N2O2 — CID 23534405
ethyl 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)-2-isocyanoacetate (PubChem CID 23534405) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)-2-isocyanoacetate.
| Compound Name | ethyl 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)-2-isocyanoacetate |
|---|---|
| PubChem CID | 23534405 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | ethyl 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)-2-isocyanoacetate |
| SMILES | [C-]#[N+]C(C(=O)OCC)=C1C=C(C)N(CCCC)C(C)=C1 |
| InChI | InChI=1S/C16H22N2O2/c1-6-8-9-18-12(3)10-14(11-13(18)4)15(17-5)16(19)20-7-2/h10-11H,6-9H2,1-4H3 |
| InChIKey | CMKBOFBBKMLIMW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|