C21H21NO6S — CID 160763041
4-[(4E)-6-tert-butyl-4-(2-ethoxy-1-isocyano-2-oxoethylidene)-1,1-dioxothiopyran-2-yl]benzoic acid (PubChem CID 160763041) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 4-[(4E)-6-tert-butyl-4-(2-ethoxy-1-isocyano-2-oxoethylidene)-1,1-dioxothiopyran-2-yl]benzoic acid.
| Compound Name | 4-[(4E)-6-tert-butyl-4-(2-ethoxy-1-isocyano-2-oxoethylidene)-1,1-dioxothiopyran-2-yl]benzoic acid |
|---|---|
| PubChem CID | 160763041 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 4-[(4E)-6-tert-butyl-4-(2-ethoxy-1-isocyano-2-oxoethylidene)-1,1-dioxothiopyran-2-yl]benzoic acid |
| SMILES | [C-]#[N+]/C(C(=O)OCC)=C1/C=C(c2ccc(C(=O)O)cc2)S(=O)(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C21H21NO6S/c1-6-28-20(25)18(22-5)15-11-16(13-7-9-14(10-8-13)19(23)24)29(26,27)17(12-15)21(2,3)4/h7-12H,6H2,1-4H3,(H,23,24)/b18-15- |
| InChIKey | RYIBAMBGXSYYNS-SDXDJHTJSA-N |
| XLogP | 3.82 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|