C18H13F2NO2 — CID 19983608
ethyl 3,3-bis(4-fluorophenyl)-2-isocyanoprop-2-enoate (PubChem CID 19983608) has the molecular formula C18H13F2NO2 and a molecular weight of 313.30 g/mol. Its IUPAC name is ethyl 3,3-bis(4-fluorophenyl)-2-isocyanoprop-2-enoate.
| Compound Name | ethyl 3,3-bis(4-fluorophenyl)-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 19983608 |
| Molecular Formula | C18H13F2NO2 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl 3,3-bis(4-fluorophenyl)-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]C(C(=O)OCC)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F2NO2/c1-3-23-18(22)17(21-2)16(12-4-8-14(19)9-5-12)13-6-10-15(20)11-7-13/h4-11H,3H2,1H3 |
| InChIKey | GLSJELAZNVMMAH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|