About ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid
ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid (PubChem CID 91089518) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid.
Molecular Properties
| Compound Name | ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid |
| PubChem CID | 91089518 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid |
| SMILES | C/C=C/c1ccc(C(=O)O)cc1.[C-]#[N+]CC(=O)OCC |
| InChI | InChI=1S/C10H10O2.C5H7NO2/c1-2-3-8-4-6-9(7-5-8)10(11)12;1-3-8-5(7)4-6-2/h2-7H,1H3,(H,11,12);3-4H2,1H3/b3-2+; |
| InChIKey | RFCORJYYQNUZAP-SQQVDAMQSA-N |
| XLogP | 2.89 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid?
The IUPAC name of ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid (CID 91089518) is ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid.
What is the SMILES notation for ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid?
The canonical SMILES for ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid is C/C=C/c1ccc(C(=O)O)cc1.[C-]#[N+]CC(=O)OCC.
What is the InChIKey of ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid?
The InChIKey is RFCORJYYQNUZAP-SQQVDAMQSA-N. The full InChI is InChI=1S/C10H10O2.C5H7NO2/c1-2-3-8-4-6-9(7-5-8)10(11)12;1-3-8-5(7)4-6-2/h2-7H,1H3,(H,11,12);3-4H2,1H3/b3-2+;.
What are the key properties of ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid?
ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid has a molecular weight of 275.30 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-isocyanoacetate;4-[(E)-prop-1-enyl]benzoic acid is sourced from PubChem (CID 91089518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).