C32H28ClN7O3 — CID 23536266
2-N-(1-benzylindazol-5-yl)-2-N-(4-chlorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536266) has the molecular formula C32H28ClN7O3 and a molecular weight of 594.08 g/mol. Its IUPAC name is 2-N-(1-benzylindazol-5-yl)-2-N-(4-chlorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1-benzylindazol-5-yl)-2-N-(4-chlorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536266 |
| Molecular Formula | C32H28ClN7O3 |
| Molecular Weight | 594.08 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 2-N-(1-benzylindazol-5-yl)-2-N-(4-chlorophenyl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(N(c3ccc(Cl)cc3)c3ccc4c(cnn4Cc4ccccc4)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C32H28ClN7O3/c1-41-28-16-24(17-29(42-2)30(28)43-3)37-31-34-20-35-32(38-31)40(25-11-9-23(33)10-12-25)26-13-14-27-22(15-26)18-36-39(27)19-21-7-5-4-6-8-21/h4-18,20H,19H2,1-3H3,(H,34,35,37,38) |
| InChIKey | AFMCPODAQHGBDS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.08 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |