C30H33F3N6O — CID 23537191
N-[4-tert-butyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 23537191) has the molecular formula C30H33F3N6O and a molecular weight of 550.63 g/mol. Its IUPAC name is N-[4-tert-butyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[4-tert-butyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23537191 |
| Molecular Formula | C30H33F3N6O |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | N-[4-tert-butyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ncnc3cc(-c4ncccc4C(F)(F)F)cnc23)cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C30H33F3N6O/c1-29(2,3)22-10-9-21(17-25(22)40-15-7-14-39-12-4-5-13-39)38-28-27-24(36-19-37-28)16-20(18-35-27)26-23(30(31,32)33)8-6-11-34-26/h6,8-11,16-19H,4-5,7,12-15H2,1-3H3,(H,36,37,38) |
| InChIKey | GZXXWBLOHNMKJX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|