C25H25F3N2O3 — CID 11328609
N-[4-tert-butyl-3-(2-hydroxyethoxy)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 11328609) has the molecular formula C25H25F3N2O3 and a molecular weight of 458.48 g/mol. Its IUPAC name is N-[4-tert-butyl-3-(2-hydroxyethoxy)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | N-[4-tert-butyl-3-(2-hydroxyethoxy)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 11328609 |
| Molecular Formula | C25H25F3N2O3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[4-tert-butyl-3-(2-hydroxyethoxy)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccc(-c3ncccc3C(F)(F)F)cc2)cc1OCCO |
| InChI | InChI=1S/C25H25F3N2O3/c1-24(2,3)19-11-10-18(15-21(19)33-14-13-31)30-23(32)17-8-6-16(7-9-17)22-20(25(26,27)28)5-4-12-29-22/h4-12,15,31H,13-14H2,1-3H3,(H,30,32) |
| InChIKey | CHTNJPBTERMMPI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |