C16H16F3N3O3S — CID 118766693
N-[2-(methanesulfonamido)ethyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 118766693) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 118766693 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-4-[3-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1ccc(-c2ncccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3N3O3S/c1-26(24,25)22-10-9-21-15(23)12-6-4-11(5-7-12)14-13(16(17,18)19)3-2-8-20-14/h2-8,22H,9-10H2,1H3,(H,21,23) |
| InChIKey | CHSKFRIKSUFGHS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|