C40H27F2N5S2 — CID 23537594
2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]-5-methylsulfanyl-1,3-thiazole (PubChem CID 23537594) has the molecular formula C40H27F2N5S2 and a molecular weight of 679.82 g/mol. Its IUPAC name is 2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]-5-methylsulfanyl-1,3-thiazole.
| Compound Name | 2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]-5-methylsulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 23537594 |
| Molecular Formula | C40H27F2N5S2 |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.17 |
| IUPAC Name | 2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]-5-methylsulfanyl-1,3-thiazole |
| SMILES | CSc1cnc(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4c(F)cccc4F)cc23)s1 |
| InChI | InChI=1S/C40H27F2N5S2/c1-48-35-23-43-39(49-35)38-30-22-26(20-21-34(30)44-25-45-38)31-24-47(46-37(31)36-32(41)18-11-19-33(36)42)40(27-12-5-2-6-13-27,28-14-7-3-8-15-28)29-16-9-4-10-17-29/h2-25H,1H3 |
| InChIKey | YSWCTGMNTXCCSW-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|