C36H27IN4S — CID 22031268
3-iodo-6-[3-(4-methylsulfanylphenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine (PubChem CID 22031268) has the molecular formula C36H27IN4S and a molecular weight of 674.61 g/mol. Its IUPAC name is 3-iodo-6-[3-(4-methylsulfanylphenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine.
| Compound Name | 3-iodo-6-[3-(4-methylsulfanylphenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 22031268 |
| Molecular Formula | C36H27IN4S |
| Molecular Weight | 674.61 g/mol |
| Exact Mass | 674.10 |
| IUPAC Name | 3-iodo-6-[3-(4-methylsulfanylphenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine |
| SMILES | CSc1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc3ncc(I)n3c2)cc1 |
| InChI | InChI=1S/C36H27IN4S/c1-42-31-20-17-26(18-21-31)35-32(27-19-22-34-38-23-33(37)40(34)24-27)25-41(39-35)36(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-25H,1H3 |
| InChIKey | SBXFLCZXYIORQQ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.61 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|