C41H28ClFN6O — CID 23537770
N-(6-chloro-3-pyridinyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537770) has the molecular formula C41H28ClFN6O and a molecular weight of 675.17 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537770 |
| Molecular Formula | C41H28ClFN6O |
| Molecular Weight | 675.17 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)cc1F |
| InChI | InChI=1S/C41H28ClFN6O/c42-38-20-18-34(24-44-38)47-40(50)35-19-16-28(22-36(35)43)37-25-45-39-21-17-29(26-48(37)39)30-23-46-49(27-30)41(31-10-4-1-5-11-31,32-12-6-2-7-13-32)33-14-8-3-9-15-33/h1-27H,(H,47,50) |
| InChIKey | VXWIJIJUYQFWKZ-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.17 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|