C43H32FN5O3S — CID 23537339
2-fluoro-N-(3-methylsulfonylphenyl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 23537339) has the molecular formula C43H32FN5O3S and a molecular weight of 717.83 g/mol. Its IUPAC name is 2-fluoro-N-(3-methylsulfonylphenyl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | 2-fluoro-N-(3-methylsulfonylphenyl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 23537339 |
| Molecular Formula | C43H32FN5O3S |
| Molecular Weight | 717.83 g/mol |
| Exact Mass | 717.22 |
| IUPAC Name | 2-fluoro-N-(3-methylsulfonylphenyl)-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2ccc(-c3cnc4ccc(-c5cnn(C(c6ccccc6)(c6ccccc6)c6ccccc6)c5)cn34)cc2F)c1 |
| InChI | InChI=1S/C43H32FN5O3S/c1-53(51,52)37-19-11-18-36(25-37)47-42(50)38-22-20-30(24-39(38)44)40-27-45-41-23-21-31(28-48(40)41)32-26-46-49(29-32)43(33-12-5-2-6-13-33,34-14-7-3-8-15-34)35-16-9-4-10-17-35/h2-29H,1H3,(H,47,50) |
| InChIKey | AULWWRABPWLFRE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.83 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|