C20H15F2NO4S — CID 2354116
N-[5-(benzenesulfonyl)-2-methoxyphenyl]-2,6-difluorobenzamide (PubChem CID 2354116) has the molecular formula C20H15F2NO4S and a molecular weight of 403.41 g/mol. Its IUPAC name is N-[5-(benzenesulfonyl)-2-methoxyphenyl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(benzenesulfonyl)-2-methoxyphenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 2354116 |
| Molecular Formula | C20H15F2NO4S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[5-(benzenesulfonyl)-2-methoxyphenyl]-2,6-difluorobenzamide |
| SMILES | COc1ccc(S(=O)(=O)c2ccccc2)cc1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C20H15F2NO4S/c1-27-18-11-10-14(28(25,26)13-6-3-2-4-7-13)12-17(18)23-20(24)19-15(21)8-5-9-16(19)22/h2-12H,1H3,(H,23,24) |
| InChIKey | MJERRGYYXJVSRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |