C14H25ClO2Si2 — CID 23541398
4-chloro-2-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenol (PubChem CID 23541398) has the molecular formula C14H25ClO2Si2 and a molecular weight of 316.98 g/mol. Its IUPAC name is 4-chloro-2-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenol.
| Compound Name | 4-chloro-2-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenol |
|---|---|
| PubChem CID | 23541398 |
| Molecular Formula | C14H25ClO2Si2 |
| Molecular Weight | 316.98 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-chloro-2-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenol |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCc1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H25ClO2Si2/c1-18(2,3)17-19(4,5)10-6-7-12-11-13(15)8-9-14(12)16/h8-9,11,16H,6-7,10H2,1-5H3 |
| InChIKey | QOAFZDZFMUCPEJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.98 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|