C22H25Cl2NO3 — CID 23544233
2-[tert-butyl(4-phenylbutyl)carbamoyl]-4,5-dichlorobenzoic acid (PubChem CID 23544233) has the molecular formula C22H25Cl2NO3 and a molecular weight of 422.35 g/mol. Its IUPAC name is 2-[tert-butyl(4-phenylbutyl)carbamoyl]-4,5-dichlorobenzoic acid.
| Compound Name | 2-[tert-butyl(4-phenylbutyl)carbamoyl]-4,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 23544233 |
| Molecular Formula | C22H25Cl2NO3 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[tert-butyl(4-phenylbutyl)carbamoyl]-4,5-dichlorobenzoic acid |
| SMILES | CC(C)(C)N(CCCCc1ccccc1)C(=O)c1cc(Cl)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C22H25Cl2NO3/c1-22(2,3)25(12-8-7-11-15-9-5-4-6-10-15)20(26)16-13-18(23)19(24)14-17(16)21(27)28/h4-6,9-10,13-14H,7-8,11-12H2,1-3H3,(H,27,28) |
| InChIKey | JBSFBSOHQHZKKS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|