C12H11Cl2NO3 — CID 1121529
4,5-dichloro-2-(pyrrolidine-1-carbonyl)benzoic acid (PubChem CID 1121529) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is 4,5-dichloro-2-(pyrrolidine-1-carbonyl)benzoic acid.
| Compound Name | 4,5-dichloro-2-(pyrrolidine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 1121529 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 4,5-dichloro-2-(pyrrolidine-1-carbonyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H11Cl2NO3/c13-9-5-7(8(12(17)18)6-10(9)14)11(16)15-3-1-2-4-15/h5-6H,1-4H2,(H,17,18) |
| InChIKey | UPFSLVQIPVPNCA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |