C11H7Cl2NO4 — CID 712315
3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoic acid (PubChem CID 712315) has the molecular formula C11H7Cl2NO4 and a molecular weight of 288.09 g/mol. Its IUPAC name is 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoic acid.
| Compound Name | 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 712315 |
| Molecular Formula | C11H7Cl2NO4 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoic acid |
| SMILES | O=C(O)CCN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C11H7Cl2NO4/c12-7-3-5-6(4-8(7)13)11(18)14(10(5)17)2-1-9(15)16/h3-4H,1-2H2,(H,15,16) |
| InChIKey | KNKIBNXMFWYSPP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|