2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid

C10H5Cl2NO4 — CID 712314

IUPAC2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid
SMILESO=C(O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O
InChIInChI=1S/C10H5Cl2NO4/c11-6-1-4-5(2-7(6)12)10(17)13(9(4)16)3-8(14)15/h1-2H,3H2,(H,14,15)
InChIKeyLHYSAUZLKMKURN-UHFFFAOYSA-N
MW274.06 g/mol
LogP1.67
Rot. Bonds2

About 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid

2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid (PubChem CID 712314) has the molecular formula C10H5Cl2NO4 and a molecular weight of 274.06 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid
PubChem CID712314
Molecular FormulaC10H5Cl2NO4
Molecular Weight274.06 g/mol
Exact Mass272.96
IUPAC Name2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid
SMILESO=C(O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O
InChIInChI=1S/C10H5Cl2NO4/c11-6-1-4-5(2-7(6)12)10(17)13(9(4)16)3-8(14)15/h1-2H,3H2,(H,14,15)
InChIKeyLHYSAUZLKMKURN-UHFFFAOYSA-N
XLogP1.67
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.06
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid?
The IUPAC name of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid (CID 712314) is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid.
What is the SMILES notation for 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid?
The canonical SMILES for 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid is O=C(O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O.
What is the InChIKey of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid?
The InChIKey is LHYSAUZLKMKURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2NO4/c11-6-1-4-5(2-7(6)12)10(17)13(9(4)16)3-8(14)15/h1-2H,3H2,(H,14,15).
What are the key properties of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid?
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid has a molecular weight of 274.06 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid is sourced from PubChem (CID 712314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).