C10H5Cl2NO4 — CID 712314
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid (PubChem CID 712314) has the molecular formula C10H5Cl2NO4 and a molecular weight of 274.06 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 712314 |
| Molecular Formula | C10H5Cl2NO4 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C10H5Cl2NO4/c11-6-1-4-5(2-7(6)12)10(17)13(9(4)16)3-8(14)15/h1-2H,3H2,(H,14,15) |
| InChIKey | LHYSAUZLKMKURN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|