C12H9Cl4NO3 — CID 1099299
2,3,4,5-tetrachloro-6-(pyrrolidine-1-carbonyl)benzoic acid (PubChem CID 1099299) has the molecular formula C12H9Cl4NO3 and a molecular weight of 357.02 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-(pyrrolidine-1-carbonyl)benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-(pyrrolidine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 1099299 |
| Molecular Formula | C12H9Cl4NO3 |
| Molecular Weight | 357.02 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-(pyrrolidine-1-carbonyl)benzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H9Cl4NO3/c13-7-5(11(18)17-3-1-2-4-17)6(12(19)20)8(14)10(16)9(7)15/h1-4H2,(H,19,20) |
| InChIKey | KKDDSLVLKBQARB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|