C14H13Cl4NO3 — CID 1099300
2-(azepane-1-carbonyl)-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 1099300) has the molecular formula C14H13Cl4NO3 and a molecular weight of 385.07 g/mol. Its IUPAC name is 2-(azepane-1-carbonyl)-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-(azepane-1-carbonyl)-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 1099300 |
| Molecular Formula | C14H13Cl4NO3 |
| Molecular Weight | 385.07 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 2-(azepane-1-carbonyl)-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H13Cl4NO3/c15-9-7(13(20)19-5-3-1-2-4-6-19)8(14(21)22)10(16)12(18)11(9)17/h1-6H2,(H,21,22) |
| InChIKey | UVKYZZQMMDTXKV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.07 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|