C11H13N3O6S2 — CID 23545063
N-[3-oxo-2-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1H-pyrazol-5-yl]methanesulfonamide (PubChem CID 23545063) has the molecular formula C11H13N3O6S2 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[3-oxo-2-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1H-pyrazol-5-yl]methanesulfonamide.
| Compound Name | N-[3-oxo-2-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1H-pyrazol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 23545063 |
| Molecular Formula | C11H13N3O6S2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | N-[3-oxo-2-[[2-(trioxidanylsulfanyl)phenyl]methyl]-1H-pyrazol-5-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(=O)n(Cc2ccccc2SOOO)[nH]1 |
| InChI | InChI=1S/C11H13N3O6S2/c1-22(17,18)13-10-6-11(15)14(12-10)7-8-4-2-3-5-9(8)21-20-19-16/h2-6,12-13,16H,7H2,1H3 |
| InChIKey | FCMTYUASMSNJCX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|