C11H12N2O4S — CID 87142698
4-[(5-methyl-3-oxo-1H-pyrazol-2-yl)methyl]benzenesulfonic acid (PubChem CID 87142698) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 4-[(5-methyl-3-oxo-1H-pyrazol-2-yl)methyl]benzenesulfonic acid.
| Compound Name | 4-[(5-methyl-3-oxo-1H-pyrazol-2-yl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87142698 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-[(5-methyl-3-oxo-1H-pyrazol-2-yl)methyl]benzenesulfonic acid |
| SMILES | Cc1cc(=O)n(Cc2ccc(S(=O)(=O)O)cc2)[nH]1 |
| InChI | InChI=1S/C11H12N2O4S/c1-8-6-11(14)13(12-8)7-9-2-4-10(5-3-9)18(15,16)17/h2-6,12H,7H2,1H3,(H,15,16,17) |
| InChIKey | DJQBOFVNSLZUSW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|