C11H9F3N2O4S — CID 54040389
4-[3-oxo-2-(2,2,2-trifluoroethyl)-1H-pyrazol-5-yl]benzenesulfonic acid (PubChem CID 54040389) has the molecular formula C11H9F3N2O4S and a molecular weight of 322.26 g/mol. Its IUPAC name is 4-[3-oxo-2-(2,2,2-trifluoroethyl)-1H-pyrazol-5-yl]benzenesulfonic acid.
| Compound Name | 4-[3-oxo-2-(2,2,2-trifluoroethyl)-1H-pyrazol-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54040389 |
| Molecular Formula | C11H9F3N2O4S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-[3-oxo-2-(2,2,2-trifluoroethyl)-1H-pyrazol-5-yl]benzenesulfonic acid |
| SMILES | O=c1cc(-c2ccc(S(=O)(=O)O)cc2)[nH]n1CC(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O4S/c12-11(13,14)6-16-10(17)5-9(15-16)7-1-3-8(4-2-7)21(18,19)20/h1-5,15H,6H2,(H,18,19,20) |
| InChIKey | LLWZVDPOVDKSSU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|