C12H12N2O6S — CID 54193013
3-oxo-2-[2-(4-sulfophenyl)ethyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 54193013) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-oxo-2-[2-(4-sulfophenyl)ethyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-oxo-2-[2-(4-sulfophenyl)ethyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 54193013 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-oxo-2-[2-(4-sulfophenyl)ethyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)n(CCc2ccc(S(=O)(=O)O)cc2)[nH]1 |
| InChI | InChI=1S/C12H12N2O6S/c15-11-7-10(12(16)17)13-14(11)6-5-8-1-3-9(4-2-8)21(18,19)20/h1-4,7,13H,5-6H2,(H,16,17)(H,18,19,20) |
| InChIKey | PJUWGAITWCTDOI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|