C36H38N6O8 — CID 23545485
tetraethyl 8,21,27,28,29,30-hexazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2,4,6(30),10(29),11,13,15,17,19(28),23(27),24-dodecaene-4,12,17,25-tetracarboxylate (PubChem CID 23545485) has the molecular formula C36H38N6O8 and a molecular weight of 682.73 g/mol. Its IUPAC name is tetraethyl 8,21,27,28,29,30-hexazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2,4,6(30),10(29),11,13,15,17,19(28),23(27),24-dodecaene-4,12,17,25-tetracarboxylate.
| Compound Name | tetraethyl 8,21,27,28,29,30-hexazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2,4,6(30),10(29),11,13,15,17,19(28),23(27),24-dodecaene-4,12,17,25-tetracarboxylate |
|---|---|
| PubChem CID | 23545485 |
| Molecular Formula | C36H38N6O8 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | tetraethyl 8,21,27,28,29,30-hexazapentacyclo[21.3.1.12,6.110,14.115,19]triaconta-1(26),2,4,6(30),10(29),11,13,15,17,19(28),23(27),24-dodecaene-4,12,17,25-tetracarboxylate |
| SMILES | CCOC(=O)c1cc2nc(c1)-c1cc(C(=O)OCC)cc(n1)CNCc1cc(C(=O)OCC)cc(n1)-c1cc(C(=O)OCC)cc(n1)CNC2 |
| InChI | InChI=1S/C36H38N6O8/c1-5-47-33(43)21-9-25-17-37-18-27-11-23(35(45)49-7-3)15-31(41-27)32-16-24(36(46)50-8-4)12-28(42-32)20-38-19-26-10-22(34(44)48-6-2)14-30(40-26)29(13-21)39-25/h9-16,37-38H,5-8,17-20H2,1-4H3 |
| InChIKey | NLMFHNWHDGABLD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 180.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|