About 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one
6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one (PubChem CID 23545807) has the molecular formula C14H28OS2
and a molecular weight of 276.51 g/mol. Its IUPAC name is 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one.
Molecular Properties
| Compound Name | 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one |
| PubChem CID | 23545807 |
| Molecular Formula | C14H28OS2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one |
| SMILES | CC(C)C(=O)C(C)C(C)C(C)SSC(C)(C)C |
| InChI | InChI=1S/C14H28OS2/c1-9(2)13(15)11(4)10(3)12(5)16-17-14(6,7)8/h9-12H,1-8H3 |
| InChIKey | VLUGXRPLYXZFMF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one?
The IUPAC name of 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one (CID 23545807) is 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one.
What is the SMILES notation for 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one?
The canonical SMILES for 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one is CC(C)C(=O)C(C)C(C)C(C)SSC(C)(C)C.
What is the InChIKey of 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one?
The InChIKey is VLUGXRPLYXZFMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28OS2/c1-9(2)13(15)11(4)10(3)12(5)16-17-14(6,7)8/h9-12H,1-8H3.
What are the key properties of 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one?
6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one has a molecular weight of 276.51 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(tert-butyldisulfanyl)-2,4,5-trimethylheptan-3-one is sourced from PubChem (CID 23545807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).