C13H10BrF5N4O2S — CID 23545974
3,3,4,4,4-pentafluorobutan-2-yl 2-[4-(4-bromopyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate (PubChem CID 23545974) has the molecular formula C13H10BrF5N4O2S and a molecular weight of 461.21 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutan-2-yl 2-[4-(4-bromopyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate.
| Compound Name | 3,3,4,4,4-pentafluorobutan-2-yl 2-[4-(4-bromopyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 23545974 |
| Molecular Formula | C13H10BrF5N4O2S |
| Molecular Weight | 461.21 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutan-2-yl 2-[4-(4-bromopyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
| SMILES | CC(OC(=O)CSc1nccc(-n2cc(Br)cn2)n1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10BrF5N4O2S/c1-7(12(15,16)13(17,18)19)25-10(24)6-26-11-20-3-2-9(22-11)23-5-8(14)4-21-23/h2-5,7H,6H2,1H3 |
| InChIKey | OIQXMVHRLJMVJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|