C13H9F7N4O2S — CID 10136772
2,2,3,3,4,4,4-heptafluorobutyl 2-(4-pyrazol-1-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 10136772) has the molecular formula C13H9F7N4O2S and a molecular weight of 418.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-(4-pyrazol-1-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-(4-pyrazol-1-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 10136772 |
| Molecular Formula | C13H9F7N4O2S |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-(4-pyrazol-1-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | O=C(CSc1nccc(-n2cccn2)n1)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F7N4O2S/c14-11(15,12(16,17)13(18,19)20)7-26-9(25)6-27-10-21-4-2-8(23-10)24-5-1-3-22-24/h1-5H,6-7H2 |
| InChIKey | HPWKQSAJDCETDF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|