(4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid

C9H18BNO4 — CID 23548999

IUPAC(4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid
SMILESCOC(=O)C1(OC)CCN(B(C)O)CC1
InChIInChI=1S/C9H18BNO4/c1-10(13)11-6-4-9(15-3,5-7-11)8(12)14-2/h13H,4-7H2,1-3H3
InChIKeyOKVNKJZHGCYTBP-UHFFFAOYSA-N
MW215.06 g/mol
LogP-0.25
Rot. Bonds3

About (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid

(4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid (PubChem CID 23548999) has the molecular formula C9H18BNO4 and a molecular weight of 215.06 g/mol. Its IUPAC name is (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid.

Molecular Properties

Compound Name(4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid
PubChem CID23548999
Molecular FormulaC9H18BNO4
Molecular Weight215.06 g/mol
Exact Mass215.13
IUPAC Name(4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid
SMILESCOC(=O)C1(OC)CCN(B(C)O)CC1
InChIInChI=1S/C9H18BNO4/c1-10(13)11-6-4-9(15-3,5-7-11)8(12)14-2/h13H,4-7H2,1-3H3
InChIKeyOKVNKJZHGCYTBP-UHFFFAOYSA-N
XLogP-0.25
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.06
LogP ≤ 5-0.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid?
The IUPAC name of (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid (CID 23548999) is (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid.
What is the SMILES notation for (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid?
The canonical SMILES for (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid is COC(=O)C1(OC)CCN(B(C)O)CC1.
What is the InChIKey of (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid?
The InChIKey is OKVNKJZHGCYTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18BNO4/c1-10(13)11-6-4-9(15-3,5-7-11)8(12)14-2/h13H,4-7H2,1-3H3.
What are the key properties of (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid?
(4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid has a molecular weight of 215.06 g/mol, XLogP of -0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-4-methoxycarbonylpiperidin-1-yl)-methylborinic acid is sourced from PubChem (CID 23548999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).