C27H22F3N5O3S — CID 23551493
5,6-difluoro-1-[[5-fluoro-1-(3-isocyanopropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]benzimidazol-2-one (PubChem CID 23551493) has the molecular formula C27H22F3N5O3S and a molecular weight of 553.57 g/mol. Its IUPAC name is 5,6-difluoro-1-[[5-fluoro-1-(3-isocyanopropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]benzimidazol-2-one.
| Compound Name | 5,6-difluoro-1-[[5-fluoro-1-(3-isocyanopropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 23551493 |
| Molecular Formula | C27H22F3N5O3S |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 5,6-difluoro-1-[[5-fluoro-1-(3-isocyanopropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]benzimidazol-2-one |
| SMILES | [C-]#[N+]CCCn1c(Cn2c(=O)n(Cc3ccc(S(C)(=O)=O)cc3)c3cc(F)c(F)cc32)nc2cc(F)ccc21 |
| InChI | InChI=1S/C27H22F3N5O3S/c1-31-10-3-11-33-23-9-6-18(28)12-22(23)32-26(33)16-35-25-14-21(30)20(29)13-24(25)34(27(35)36)15-17-4-7-19(8-5-17)39(2,37)38/h4-9,12-14H,3,10-11,15-16H2,2H3 |
| InChIKey | ZUKIPHHHAXINPH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|